| Current Path : /home/ereika83/www/wp-content/plugins/unbounce/ |
| Current File : /home/ereika83/www/wp-content/plugins/unbounce/UBDiagnostics.php |
<?php
class UBDiagnostics
{
const SUPPORTED_PHP_VERSION = '5.3';
const SUPPORTED_WP_VERSION = '4.0';
public static function checks($domain, $domain_info)
{
return array_merge(self::domain_checks($domain, $domain_info), self::system_checks());
}
public static function domain_checks($domain, $domain_info)
{
$dynamic_config = get_option(UBConfig::UB_DYNAMIC_CONFIG_CACHE_KEY, array());
$uuid = get_option(UBConfig::UB_DOMAIN_UUID_KEY, '');
$result = array(
'Domain is Authorized' => UBConfig::is_authorized_domain($domain),
'Can Fetch Page Listing' => UBDiagnostics::last_status_success($domain_info)
);
if (UBConfig::has_authorized()) {
$result['Domain UUID'] = $uuid !== '';
}
if (isset($dynamic_config['last_status'])) {
$result['Dynamic Config Retrieval'] = $dynamic_config['last_status'] !== 'FAILURE';
}
return $result;
}
public static function system_checks()
{
return array(
'Curl Support' => self::is_curl_installed(),
'XML Support' => self::is_xml_installed(),
'Permalink Structure' => get_option('permalink_structure', '') !== '',
'Supported PHP Version' => version_compare(
phpversion(),
UBDiagnostics::SUPPORTED_PHP_VERSION,
'>='
),
'Supported Wordpress Version' => version_compare(
UBDiagnostics::wordpress_version(),
UBDiagnostics::SUPPORTED_WP_VERSION,
'>='
),
'SNI Support' => self::has_sni(),
);
}
public static function has_sni()
{
return defined('OPENSSL_TLSEXT_SERVER_NAME') && OPENSSL_TLSEXT_SERVER_NAME;
}
public static function is_curl_installed()
{
return function_exists('curl_init');
}
public static function is_xml_installed()
{
return function_exists('simplexml_load_string');
}
public static function should_show_warning($domain, $domain_info)
{
$domain_issue = in_array(false, self::domain_checks($domain, $domain_info));
$system_issue = in_array(false, self::system_checks());
if (UBConfig::has_authorized()) {
return $domain_issue || $system_issue;
} else {
return $system_issue;
}
}
/**
* Format a variable as condensed human-readable output
* Example: non-assoc arrays are output as [foo, bar] and assoc looks like
* [
* foo: 'bar'
* baz: NULL
* ]
* @param mixed $var
* @param int $level
* @return string
*/
private static function pp($var, $level = 1)
{
$str = '';
if (is_array($var)) {
$simple = empty($var) ? true : array_keys($var) === range(0, count($var) -1);
$str .= '[';
if ($simple) {
$str .= implode(', ', $var);
} else {
foreach ($var as $key => $value) {
$str .= "\n" . str_repeat(' ', $level) . "$key: " . self::pp($value, $level + 1);
}
}
$str .= ']';
} else {
$str = var_export($var, true);
}
return $str;
}
public static function details($domain, $domain_info)
{
return array(
'PHP Version' => phpversion(),
'WordPress Version' => UBDiagnostics::wordpress_version(),
'Unbounce Plugin Version' => '1.1.2',
'Checks' => self::pp(UBDiagnostics::checks($domain, $domain_info)),
'Options' => self::pp(UBDiagnostics::ub_options()),
'Permalink Structure' => get_option('permalink_structure', ''),
'Domain' => $domain,
'Domain Authorized' => self::pp(UBConfig::is_authorized_domain($domain)),
'Has Authorized' => self::pp(UBConfig::has_authorized()),
'Active Plugins' => self::pp(get_option('active_plugins')),
'Plugin Details' => self::pp(get_plugins()),
'Curl Version' => self::pp(UBDiagnostics::curl_version()),
'SNI Support' => self::has_sni(),
'Configuration Options' => self::pp(self::phpConfig()),
'Extensions' => self::pp(get_loaded_extensions()),
'Operating System' => php_uname(),
);
}
private static function phpConfig()
{
return ini_get_all(null, false);
}
private static function ub_options()
{
$ub_options = array();
array_walk(UBConfig::ub_option_defaults(), function ($v, $k) use (&$ub_options) {
$ub_options[$k] = get_option($k, $v);
});
return $ub_options;
}
private static function curl_version()
{
if (function_exists('curl_version')) {
return curl_version();
} else {
return 'N/A';
}
}
public static function wordpress_version()
{
global $wp_version;
include(ABSPATH . WPINC . '/version.php');
return $wp_version;
}
private static function last_status_success($domain_info)
{
$last_status = UBUtil::array_fetch($domain_info, 'last_status');
return $last_status !== null && $last_status !== 'FAILURE';
}
/**
* Perform a sitemap request with default parameters to test communication with unbounce
* @return array
*/
public static function testSiteMapRequest()
{
$res = UBConfig::fetch_proxyable_url_set(UBConfig::domain(), null, UBConfig::page_server_domain());
if (!is_array($res) || !isset($res[0])) {
return array(
'status' => 'ERROR',
'result' => var_export($res, true),
);
}
return $res[0];
}
/**
* Retrieve environment details relevant at plugin activation time
* @return array
*/
public static function installationDetails()
{
return array(
'php' => phpversion(),
'wordpress' => UBDiagnostics::wordpress_version(),
'plugin_version' => '1.1.2',
'curl_installed' => self::is_curl_installed(),
'xml_installed' => self::is_xml_installed(),
'sni_support' => self::has_sni(),
'permalink_structure' => get_option('permalink_structure'),
'domain' => UBConfig::domain(),
'active_plugins' => get_option('active_plugins'),
'curl_version' => UBDiagnostics::curl_version(),
'php_config' => UBUtil::array_select_by_key(
self::phpConfig(),
array(
'allow_url_fopen', 'cgi.discard_path', 'cgi.fix_pathinfo', 'curl.cainfo', 'default_charset',
'default_socket_timeout', 'disable_functions', 'display_errors', 'error_reporting',
'enable_post_data_reading', 'file_uploads', 'implicit_flush', 'memory_limit', 'max_execution_time',
'max_input_time', 'opcache.enable', 'openssl.cafile', 'openssl.capath', 'output_buffering',
'output_encoding', 'output_handler', 'post_max_size', 'short_open_tag', 'upload_max_filesize',
)
),
'php_extensions' => get_loaded_extensions(),
'os' => php_uname(),
);
}
}